| Company Name: |
Beijing Fuchen Technology Co., Ltd Gold
|
| Tel: |
15652759959 |
| Email: |
623245911@qq.com |
| Products Intro: |
Product Name:(S)-4-amino-3,3-dimethylpiperidine-1-carboxylate
CAS:1357600-60-2
Purity:95+% Package:1g
|
| Company Name: |
Nantong MYBio-pharm. Co., Ltd.
|
| Tel: |
0513-85921823 18662920231 |
| Email: |
sales@ntminyanmedical.com |
| Products Intro: |
Product Name:(S)-tert-Butyl 4-amino-3,3-dimethylpiperidine-1-carboxylate
CAS:1357600-60-2
Purity:95 Package:1g
|
|
| | (S)-4-Amino-3,3-dimethyl-piperidine-1-carboxylic acid tert-butyl ester Basic information |
| Product Name: | (S)-4-Amino-3,3-dimethyl-piperidine-1-carboxylic acid tert-butyl ester | | Synonyms: | (S)-4-Amino-3,3-dimethyl-piperidine-1-carboxylic acid tert-butyl ester;1-Piperidinecarboxylic acid, 4-amino-3,3-dimethyl-, 1,1-dimethylethyl ester, (4S)-;(S)-1-Boc-4-amino-3,3-dimethylpiperidine;(S)-4-amino-3,3-dimethylpiperidine-1-carboxylate;tert-butyl (4S)-4-amino-3,3-dimethylpiperidine-1-carboxylate - [B82497];tert-butyl (S)-4-amino-3,3-dimethylpiperidine-1-carboxylate | | CAS: | 1357600-60-2 | | MF: | C12H24N2O2 | | MW: | 228.33 | | EINECS: | | | Product Categories: | | | Mol File: | 1357600-60-2.mol |  |
| | (S)-4-Amino-3,3-dimethyl-piperidine-1-carboxylic acid tert-butyl ester Chemical Properties |
| Boiling point | 293.9±33.0 °C(Predicted) | | density | 0.989±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 10.14±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C12H24N2O2/c1-11(2,3)16-10(15)14-7-6-9(13)12(4,5)8-14/h9H,6-8,13H2,1-5H3/t9-/m0/s1 | | InChIKey | MNJCZOJFFXXZKR-VIFPVBQESA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC[C@H](N)C(C)(C)C1 |
| | (S)-4-Amino-3,3-dimethyl-piperidine-1-carboxylic acid tert-butyl ester Usage And Synthesis |
| | (S)-4-Amino-3,3-dimethyl-piperidine-1-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|