| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Strontium 2,4-pentanedionate Basic information |
| Product Name: | Strontium 2,4-pentanedionate | | Synonyms: | STRONTIUM ACETYLACETONATE;bis(pentane-2,4-dionato-O,O')strontium;sr(acac)2;STRONTIUMACETYLACETONATEHYDRATE,99%;strontium(II) acetylacetonate;Strontium-2,4-Pentanedionate 99.99%;Strontium acetylacetonate hydrate 99.99%;24Pentanedioneion(1) strontium | | CAS: | 12193-47-4 | | MF: | C5H7O2Sr+ | | MW: | 186.73 | | EINECS: | 235-366-2 | | Product Categories: | metal beta-diketonate complexes | | Mol File: | 12193-47-4.mol |  |
| | Strontium 2,4-pentanedionate Chemical Properties |
| Melting point | 220°C (dec.) | | solubility | Soluble in warm methoxyethanol, pyridine | | form | Powder | | color | white | | InChI | 1S/2C5H8O2.Sr/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; | | InChIKey | UMBFGWVRZIHXCK-FDGPNNRMSA-L | | SMILES | CC(=O)\C=C(\C)O[Sr]O\C(C)=C/C(C)=O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-40 | | Safety Statements | 26-28-36/37/39-45 | | WGK Germany | 3 | | TSCA | No | | HS Code | 2914199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Strontium 2,4-pentanedionate Usage And Synthesis |
| Chemical Properties | white powder(s) [STR93] | | Uses | Strontium 2,4-pentanedionate hydrate is used as a building block & and in the inorganic chemical synthesis. | | reaction suitability | core: strontium
reagent type: catalyst |
| | Strontium 2,4-pentanedionate Preparation Products And Raw materials |
|