|
|
| | 2,4-Dichloro-3,5-dinitrobenzotrifluoride Basic information |
| Product Name: | 2,4-Dichloro-3,5-dinitrobenzotrifluoride | | Synonyms: | 2,4-dichloro-1,3-dinitro-5-(trifluoromethyl)-benzen;2,4-DICHLORO-3,5-DINITROBENZOTRIFLUORIDE;2,4-Dichloro-3,5-dinitrotrifluoromethylbenzene;2,4-Dichloro-3,5-Dinitrobenzotrifluoride/3,5-Dinitro-2,4-Dichlorobenzotrifluoride;2,4-Dichloro-3,5-dinitrobenzotrifluoride 98%;2,4-Dichloro-3,5-dinitrobenzotrifluoride98%;BENZENE,2,4-DICHLORO-1,3-DINITRO-5-(TRIFLUOROMETHYL);2,4-Dichloro-3,5-Dinitrobenzotrifluoride/3,5-Dinitro-2,4-Dichlo | | CAS: | 29091-09-6 | | MF: | C7HCl2F3N2O4 | | MW: | 304.99 | | EINECS: | 249-420-8 | | Product Categories: | Intermediate for Pesticide, Pharmaceutical and organic synthesis | | Mol File: | 29091-09-6.mol |  |
| | 2,4-Dichloro-3,5-dinitrobenzotrifluoride Chemical Properties |
| Melting point | 76-78°C | | Boiling point | 291-294°C | | density | 1.788±0.06 g/cm3(Predicted) | | vapor pressure | 0.113Pa at 25℃ | | Fp | >110°C | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Light Yellow | | BRN | 2062037 | | InChI | InChI=1S/C7HCl2F3N2O4/c8-4-2(7(10,11)12)1-3(13(15)16)5(9)6(4)14(17)18/h1H | | InChIKey | DPQYRXNRGNLPFC-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=CC(C(F)(F)F)=C(Cl)C([N+]([O-])=O)=C1Cl | | LogP | 3.88 | | CAS DataBase Reference | 29091-09-6(CAS DataBase Reference) | | EPA Substance Registry System | 2,4-Dichloro-3,5-dinitrobenzotrifluoride (29091-09-6) |
| | 2,4-Dichloro-3,5-dinitrobenzotrifluoride Usage And Synthesis |
| Chemical Properties | White to light yellow crystal powde | | Uses | 2,4-Dichloro-3,5-dinitrobenzotrifluoride is a reagent used in the synthesis of kinesin spindle protein inhibitors. Potential use as an alternative to neurotoxic MT inhibitors. |
| | 2,4-Dichloro-3,5-dinitrobenzotrifluoride Preparation Products And Raw materials |
|