|
|
| | 10-(4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl)-10H-phenoxazine Basic information |
| Product Name: | 10-(4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl)-10H-phenoxazine | | Synonyms: | 10-(4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl)-10H-phenoxazine;PXZ-TRZ;10H-Phenoxazine, 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-;10-(4-(4,6-Diphenyll-1,3,5-triazin-2-yl)phenyl)-10hydro-phenoxazine | | CAS: | 1411910-25-2 | | MF: | C33H22N4O | | MW: | 490.55 | | EINECS: | | | Product Categories: | | | Mol File: | 1411910-25-2.mol |  |
| | 10-(4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl)-10H-phenoxazine Chemical Properties |
| Boiling point | 713.4±63.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | form | powder/crystals | | pka | 0.91±0.10(Predicted) | | color | Yellow | | InChI | InChI=1S/C33H22N4O/c1-3-11-23(12-4-1)31-34-32(24-13-5-2-6-14-24)36-33(35-31)25-19-21-26(22-20-25)37-27-15-7-9-17-29(27)38-30-18-10-8-16-28(30)37/h1-22H | | InChIKey | ZABORCXHTNWZRV-UHFFFAOYSA-N | | SMILES | C1=C2C(OC3=C(N2C2=CC=C(C4=NC(C5=CC=CC=C5)=NC(C5=CC=CC=C5)=N4)C=C2)C=CC=C3)=CC=C1 | | Absorption | λmax 420 nm (in Toluene) | | Melting point | TGA: >300 °C(0.5% weight loss) | | Fluorescene | λem 545 nm (in Toluene) |
| | 10-(4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl)-10H-phenoxazine Usage And Synthesis |
| Description | PXZ-TRZ, namely phenoxazine-2,4,6-triphenyl-1,3,5-triazine, has a bipolar structure with phenoxazine (PXZ) as an electron donor unit and 2,4,6-triphenyl-1,3,5-triazine (TRZ) as an electron acceptor unit. |
| | 10-(4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl)-10H-phenoxazine Preparation Products And Raw materials |
|