|
|
| | ethyl 5-acetyl-1H-pyrazole-3-carboxylate Basic information | | Uses |
| Product Name: | ethyl 5-acetyl-1H-pyrazole-3-carboxylate | | Synonyms: | ethyl 5-acetyl-1H-pyrazole-3-carboxylate;ethyl 5-acetyl 1H-pyrazol-3-carboxylate;5-Acetyl-2H-Pyrazole-3-Carboxylic Acid Ethyl Ester;3-ETHOXYCARBONYL-5-ACETYLPYRAZOLE;5-ACETYL-1(2)H-PYRAZOLE-3-CARBOXYLIC ACID ETHYL ESTER;5-Acetyl-2H-Pyrazole-3-Carboxylic Acid Ethyl Ester(WX626065);1H-Pyrazole-3-carboxylic acid, 5-acetyl-, ethyl ester;ethyl 3-acetyl-1H-pyrazole-5-carboxylate | | CAS: | 37622-89-2 | | MF: | C8H10N2O3 | | MW: | 182.18 | | EINECS: | | | Product Categories: | | | Mol File: | 37622-89-2.mol |  |
| | ethyl 5-acetyl-1H-pyrazole-3-carboxylate Chemical Properties |
| Melting point | 112-112.5 °C(Solv: water (7732-18-5)) | | Boiling point | 382.6±27.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.00±0.10(Predicted) | | color | Brown to Dark Yellow | | InChI | InChI=1S/C8H10N2O3/c1-3-13-8(12)7-4-6(5(2)11)9-10-7/h4H,3H2,1-2H3,(H,9,10) | | InChIKey | DUGSTTIFTRKIBL-UHFFFAOYSA-N | | SMILES | N1C(C(C)=O)=CC(C(OCC)=O)=N1 |
| | ethyl 5-acetyl-1H-pyrazole-3-carboxylate Usage And Synthesis |
| Uses | Ethyl 5-acetyl-1H-pyrazole-3-carboxylate can be used as a pharmaceutical intermediate, such as in the synthesis of dalurouamide. |
| | ethyl 5-acetyl-1H-pyrazole-3-carboxylate Preparation Products And Raw materials |
|