| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 2-chloro-6-(trimethylsilyl)phenyl trifluoromethanesulfonate Basic information |
| | 2-chloro-6-(trimethylsilyl)phenyl trifluoromethanesulfonate Chemical Properties |
| Boiling point | 319.3±42.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | liquid | | InChI | 1S/C10H12ClF3O3SSi/c1-19(2,3)8-6-4-5-7(11)9(8)17-18(15,16)10(12,13)14/h4-6H,1-3H3 | | InChIKey | QFWUIGWOSVHZMC-UHFFFAOYSA-N | | SMILES | ClC1=C(OS(=O)(C(F)(F)F)=O)C([Si](C)(C)C)=CC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-chloro-6-(trimethylsilyl)phenyl trifluoromethanesulfonate Usage And Synthesis |
| Uses | 2-Chloro-6-(trimethylsilyl)phenyl Trifluoromethanesulfonate is used in the preparation of aryne precursors for selective generation of haloarynes. | | Uses | Chlorosilyltriflate has been shown to be a useful precursor for the generation of a chlorobenzyne intermediate. The chlorobenzyne intermediate can be generated in the presence of Cesium or Potassium Fluoride and can be trapped with various dipolariphiles. |
| | 2-chloro-6-(trimethylsilyl)phenyl trifluoromethanesulfonate Preparation Products And Raw materials |
|