(S)-Amisulpride manufacturers
- (S)-Amisulpride
-
- $30.00
-
2026-07-27
- CAS:71675-92-8
- Purity: 98.38%
- Supply Ability: 10g
|
| | (S)-Amisulpride Basic information |
| Product Name: | (S)-Amisulpride | | Synonyms: | (S)-Amisulpride;4-Amino-N-[[(2S)-1-ethyl-2-pyrrolidinyl]methyl]-5-(ethylsulfonyl)-2-methoxybenzamide;Benzamide, 4-amino-N-[[(2S)-1-ethyl-2-pyrrolidinyl]methyl]-5-(ethylsulfonyl)-2-methoxy-;Amisulpride Impurity 35;(S)-Amisulpride, 10 mM in DMSO;(S)-4-amino-N-((1-ethylpyrrolidin-2-yl)methyl)-5-(ethylsulfonyl)-2-methoxybenzamide;Esamisulpride;SEP-4199 | | CAS: | 71675-92-8 | | MF: | C17H27N3O4S | | MW: | 369.48 | | EINECS: | | | Product Categories: | | | Mol File: | 71675-92-8.mol |  |
| | (S)-Amisulpride Chemical Properties |
| Melting point | >54°C (dec.) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Yellow | | InChI | InChI=1S/C17H27N3O4S/c1-4-20-8-6-7-12(20)11-19-17(21)13-9-16(25(22,23)5-2)14(18)10-15(13)24-3/h9-10,12H,4-8,11,18H2,1-3H3,(H,19,21)/t12-/m0/s1 | | InChIKey | NTJOBXMMWNYJFB-LBPRGKRZSA-N | | SMILES | C(NC[C@@H]1CCCN1CC)(=O)C1=CC(S(CC)(=O)=O)=C(N)C=C1OC |
| | (S)-Amisulpride Usage And Synthesis |
| Uses | S-Amisulpride is an isomer of the antipsychotic Amisulpride (A633250). S-Amisulpride has been shown to produce a maximal increase in prolactin level similar to that of the racemic form of Amisulpride. | | in vivo | The (S)-amisulpride (10mg/kg, s.c.) stimulus is rapidly acquired and was shown to be dose-related, time dependent (effective between 30 and 120min) and stereoselective male C57BL/6 mice[1]. | | IC 50 | D2 Receptor; D3 Receptor; 5-HT7 Receptor: 900 nM (Ki) |
| | (S)-Amisulpride Preparation Products And Raw materials |
|