methyl2-(chloromethyl)-4-phenoxybenzoate manufacturers
|
| | methyl2-(chloromethyl)-4-phenoxybenzoate Basic information |
| | methyl2-(chloromethyl)-4-phenoxybenzoate Chemical Properties |
| Boiling point | 407.9±45.0 °C(Predicted) | | density | 1.226±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C15H13ClO3/c1-18-15(17)14-8-7-13(9-11(14)10-16)19-12-5-3-2-4-6-12/h2-9H,10H2,1H3 | | InChIKey | YDISGIKGRQZDOU-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(OC2=CC=CC=C2)C=C1CCl |
| | methyl2-(chloromethyl)-4-phenoxybenzoate Usage And Synthesis |
| Uses | methyl2-(chloromethyl)-4-phenoxybenzoate is a pharmaceutical intermediate compound used in the preparation of roxadustat, a hypoxia-inducible factor (HIF) prolyl hydroxylase inhibitor used in the treatment of symptomatic conditions associated with chronic kidney disease (CKD). |
| | methyl2-(chloromethyl)-4-phenoxybenzoate Preparation Products And Raw materials |
|