| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Garg 4,5-indolyne precusor CAS:1259448-37-7 Purity:95% Package:1G Remarks:795569-1G
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Garg 4,5-indolyne precusor 95% CAS:1259448-37-7 Purity:95% Package:1g Remarks:NULL
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Garg 4,5-indolyne precursor CAS:1259448-37-7
|
|
| | Garg 4,5-indolyne precusor 95% Basic information |
| Product Name: | Garg 4,5-indolyne precusor 95% | | Synonyms: | Garg 4,5-indolyne precusor 95%;Garg 4,5-indolyne precusor;Methanesulfonic acid, 1,1,1-trifluoro-, 4-(trimethylsilyl)-1H-indol-5-yl ester;Garg 4,5-indolyne precursor | | CAS: | 1259448-37-7 | | MF: | C12H14F3NO3SSi | | MW: | 337.39 | | EINECS: | | | Product Categories: | | | Mol File: | 1259448-37-7.mol |  |
| | Garg 4,5-indolyne precusor 95% Chemical Properties |
| Melting point | 43-48°C | | Fp | >110℃ | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C12H14F3NO3SSi/c1-21(2,3)11-8-6-7-16-9(8)4-5-10(11)19-20(17,18)12(13,14)15/h4-7,16H,1-3H3 | | InChIKey | LLCJFYYASDIOJN-UHFFFAOYSA-N | | SMILES | O=S(OC1=C([Si](C)(C)C)C2=C(NC=C2)C=C1)(C(F)(F)F)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Garg 4,5-indolyne precusor 95% Usage And Synthesis |
| Uses | Indolyne precursor can be activated under mild fluoride conditions, which are highly reactive with dienes and other dipolariphiles (e.g. azides) to provide cycloaddition products containing an indole motif. | | General Description | Garg 4,5-indolyne precursor is an indolyne precursor developed by Professor Neil Garg and coworkers. It is widely used for the synthesis of various N-heterocyclic based compounds. It is also useful for the preparation of substituted indoles (Diels–Alder and azide cycloaddition products). |
| | Garg 4,5-indolyne precusor 95% Preparation Products And Raw materials |
|