2,6,14-triaminotriptycene manufacturers
|
| | 2,6,14-triaminotriptycene Basic information |
| Product Name: | 2,6,14-triaminotriptycene | | Synonyms: | 2,6,14-triaminotriptycene;9,10[1',2']-Benzenoanthracene-2,6,14-triamine, 9,10-dihydro-;9,10-Dihydro-9,10-[1,2]benzenoanthracene-2,6,14-triamine;pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11,17-triamine | | CAS: | 58519-06-5 | | MF: | C20H17N3 | | MW: | 299.38 | | EINECS: | | | Product Categories: | | | Mol File: | 58519-06-5.mol |  |
| | 2,6,14-triaminotriptycene Chemical Properties |
| Melting point | 279-283 °C (decomp) | | Boiling point | 534.7±50.0 °C(Predicted) | | density | 1.365±0.06 g/cm3(Predicted) | | pka | 5.20±0.20(Predicted) | | InChI | InChI=1S/C20H17N3/c21-10-3-6-15-16(7-10)19-13-4-1-11(22)8-17(13)20(15)18-9-12(23)2-5-14(18)19/h1-9,19-20H,21-23H2 | | InChIKey | CKKNNPPUUXLVDT-UHFFFAOYSA-N | | SMILES | NC1=CC=C2C3C4=CC(N)=CC=C4C(C4=CC=C(N)C=C43)C2=C1 |
| | 2,6,14-triaminotriptycene Usage And Synthesis |
| Uses | 2,6,14-Triaminotriptycene is used as a monomer for the synthesis of COF materials: ALP-1; TB-MOP; HF-MOP; PDI-Tc; NDI-Tc; HT-PA-1-4. |
| | 2,6,14-triaminotriptycene Preparation Products And Raw materials |
|