- 2-Amino-6-methoxypyridine
-
- $5.00 / 1KG
-
2025-09-25
- CAS:17920-35-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-Amino-6-methoxypyridine Basic information |
| | 2-Amino-6-methoxypyridine Chemical Properties |
| Boiling point | 115°C/13mmHg(lit.) | | density | 1.139±0.06 g/cm3(Predicted) | | refractive index | 1.5760-1.5800 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Liquid | | pka | 4.62±0.24(Predicted) | | color | Brown | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C6H8N2O/c1-9-6-4-2-3-5(7)8-6/h2-4H,1H3,(H2,7,8) | | InChIKey | DEUALFRBMNMGDS-UHFFFAOYSA-N | | SMILES | C1(N)=NC(OC)=CC=C1 | | CAS DataBase Reference | 17920-35-3(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | 6.1 | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 2-Amino-6-methoxypyridine Usage And Synthesis |
| Uses | It's an important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. |
| | 2-Amino-6-methoxypyridine Preparation Products And Raw materials |
|