| Company Name: |
ChemShuttle, Inc. |
| Tel: |
0510-83588313-811 18800520310 |
| Email: |
sales@chemshuttle.com |
|
| | L-Proline, 4-hydroxy-1-methyl-, trans- Basic information |
| Product Name: | L-Proline, 4-hydroxy-1-methyl-, trans- | | Synonyms: | L-Proline, 4-hydroxy-1-methyl-, trans-;(2S,4R)-4-Hydroxy-1-methylpyrrolidine-2-carboxylic acid;124811;L-Proline, 4-hydroxy-1-methyl-, (4R)-;4-Hydroxyhygrinic acid;(2S,4R)-4-hydroxy-1-methylpyrrolidine-2-carboxylic acid - [H86740];4-Hydroxyhygric acid | | CAS: | 4252-82-8 | | MF: | C6H11NO3 | | MW: | 145.16 | | EINECS: | | | Product Categories: | | | Mol File: | 4252-82-8.mol |  |
| | L-Proline, 4-hydroxy-1-methyl-, trans- Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | Solid | | Boiling point | 316.2±42.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | Melting point | 238-240 °C (decomp) | | pKa | 2.15±0.40(Predicted) | | color | White to off-white | | Optical Rotation | -83.2° (C=0.3275 g/100ml H2O) | | InChI | 1S/C6H11NO3/c1-7-3-4(8)2-5(7)6(9)10/h4-5,8H,2-3H2,1H3,(H,9,10)/t4-,5+/m1/s1 | | InChIKey | FMIPNAUMSPFTHK-UHNVWZDZSA-N | | SMILES | O[C@@H]1C[C@@H](C(O)=O)N(C)C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | L-Proline, 4-hydroxy-1-methyl-, trans- Usage And Synthesis |
| Uses | (4R)-4-Hydroxy-1-methyl-L-proline is found in tamarix species and increases with increasing salt stress. | | Definition | ChEBI: (R)-4-hydroxy-1-methyl-L-proline is an L-proline derivative that is trans-4-hydroxy-L-proline in which the amino hydrogen has been replaced by a methyl group. It has a role as a plant metabolite and an anti-HIV-1 agent. It is a L-proline derivative and a pyrrolidine alkaloid. It is functionally related to a trans-4-hydroxy-L-proline. |
| | L-Proline, 4-hydroxy-1-methyl-, trans- Preparation Products And Raw materials |
|