|
|
| | (1R,2R)-(-)-2-Amino-1-phenyl-1,3-propanediol Basic information |
| Product Name: | (1R,2R)-(-)-2-Amino-1-phenyl-1,3-propanediol | | Synonyms: | (1R,2R)-(-)-2-AMINO-1-PHENYL-1,3-PROPANEDIOL;(1R,2R)-2-AMINO-1-PHENYLPROPANE-1,3-DIOL;(2R,3R)-3-PHENYLSERINOL;(2R,3S)-PHENYLSERINOL;[R(R*,R*)]-2-amino-1-phenylpropane-1,3-diol;(1R,2S)-3-Phenylserinol;1,3-Propanediol, 2-amino-1-phenyl-, [R-(R*,R*)]-;(1R,2R)-1-Phenyl-2-amino-1,3-propanediol | | CAS: | 46032-98-8 | | MF: | C9H13NO2 | | MW: | 167.21 | | EINECS: | 256-250-8 | | Product Categories: | Amino Alcohols (Chiral);Asymmetric Synthesis;Chiral Building Blocks;Synthetic Organic Chemistry;Amino Alcohols;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 46032-98-8.mol |  |
| | (1R,2R)-(-)-2-Amino-1-phenyl-1,3-propanediol Chemical Properties |
| Melting point | 112-118 °C (lit.) | | alpha | -39 º (c=1, 1N HCl) | | Boiling point | 295.79°C (rough estimate) | | density | 1.1222 (rough estimate) | | refractive index | -26.5 ° (C=1, MeOH) | | storage temp. | 2-8°C, protect from light | | pka | 11.73±0.45(Predicted) | | Appearance | Light yellow to light brown Solid | | Optical Rotation | [α]23/D 37°, c = 1 in 1 M HCl | | InChI | 1S/C9H13NO2/c10-8(6-11)9(12)7-4-2-1-3-5-7/h1-5,8-9,11-12H,6,10H2/t8-,9-/m1/s1 | | InChIKey | JUCGVCVPNPBJIG-RKDXNWHRSA-N | | SMILES | N[C@H](CO)[C@H](O)c1ccccc1 | | CAS DataBase Reference | 46032-98-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | RIDADR | UN 3259 8/PG 3 | | WGK Germany | 3 | | HS Code | 29221985 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (1R,2R)-(-)-2-Amino-1-phenyl-1,3-propanediol Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | (1R,2R)-()-2-Amino-1-phenyl-1,3-propanediol can be used as a starting material to prepare:
- Diaryl sulfides, used to synthesize sulfimides and N-tosylsulfimides, applicable as chiral ligands.
- (S,S)-Reboxetine, a selective norepinephrine reuptake inhibitor (NRI).
- L-2-Mercaptosuccinic acid, used in the synthesis of polyester with mercapto group.
|
| | (1R,2R)-(-)-2-Amino-1-phenyl-1,3-propanediol Preparation Products And Raw materials |
|