2-AMINO-5,6-DIHYDRO-1,3-BENZOTHIAZOL-7(4H)-ONE manufacturers
|
| | 2-AMINO-5,6-DIHYDRO-1,3-BENZOTHIAZOL-7(4H)-ONE Basic information |
| Product Name: | 2-AMINO-5,6-DIHYDRO-1,3-BENZOTHIAZOL-7(4H)-ONE | | Synonyms: | IFLAB-BB F1303-0001;2-amino-5,6-dihydrobenzo[d]thiazol-7(4H)-one;2-AMINO-5,6-DIHYDRO-1,3-BENZOTHIAZOL-7(4H)-ONE;2-AMINO-5,6-DIHYDRO-4H-BENZOTHIAZOL-7-ONE;7(4H)-Benzothiazolone, 2-aMino-5,6-dihydro-;2-amino-5,6-dihydro-7(4H)-Benzothiazolone;2-amino-5,6-dihydro-4H-1,3-benzothiazol-7-one;2-Amino-5,6-Dihydro-4H-Benzothiazol-7-One(WX140896) | | CAS: | 17583-10-7 | | MF: | C7H8N2OS | | MW: | 168.22 | | EINECS: | | | Product Categories: | | | Mol File: | 17583-10-7.mol |  |
| | 2-AMINO-5,6-DIHYDRO-1,3-BENZOTHIAZOL-7(4H)-ONE Chemical Properties |
| Melting point | 269-270 °C(Solv: ethyl acetate (141-78-6)) | | Boiling point | 376.0±11.0 °C(Predicted) | | density | 1.428±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMSO (Sparingly) | | form | Solid | | pka | 3.36±0.20(Predicted) | | color | Light Yellow | | InChI | InChI=1S/C7H8N2OS/c8-7-9-4-2-1-3-5(10)6(4)11-7/h1-3H2,(H2,8,9) | | InChIKey | JAZOMJIYYHHUBH-UHFFFAOYSA-N | | SMILES | S1C2C(=O)CCCC=2N=C1N |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | HazardClass | IRRITANT |
| | 2-AMINO-5,6-DIHYDRO-1,3-BENZOTHIAZOL-7(4H)-ONE Usage And Synthesis |
| Synthesis | Step ii: Synthesis of 2-amino-5,6-dihydrobenzo[d]thiazol-7(4H)-one
To a 100 mL round bottom flask was added 2-bromo-1,3-cyclohexanedione (1.0 g, 5.23 mmol) and methanol (15 mL). Subsequently, thiourea (0.397 g, 5.23 mmol) and pyridine (0.412 g, 5.23 mmol) were added to the same flask. The reaction mixture was heated to reflux temperature and stirred for 4 hours. After completion of the reaction, the volatile solvent was removed by distillation under reduced pressure to give the crude product. The crude product was dissolved in water and stirred for 5 min to promote the formation of precipitate. The precipitate was collected by filtration and washed with distilled water to give the final 2-amino-5,6-dihydrobenzo[d]thiazol-7(4H)-one (0.8 g, 91% yield).
Product characterization data:
1H NMR (300 MHz, DMSO-d6): δ 8.12 (brs, 2H), 2.69 (t, 2H), 2.38 (t, 2H), 2.02 (m, 2H).
LC-MS (ESI): m/z 168.9 [M + H]+. | | References | [1] Patent: WO2015/101928, 2015, A1. Location in patent: Page/Page column 100 [2] Journal of Medicinal Chemistry, 2010, vol. 53, # 5, p. 2136 - 2145 [3] Pharmaceutical Chemistry Journal, 1993, vol. 27, # 7, p. 500 - 503 [4] Khimiko-Farmatsevticheskii Zhurnal, 1993, vol. 27, # 7, p. 37 - 39 [5] Patent: WO2005/5438, 2005, A1. Location in patent: Page/Page column 36 |
| | 2-AMINO-5,6-DIHYDRO-1,3-BENZOTHIAZOL-7(4H)-ONE Preparation Products And Raw materials |
|