| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:ScandiuM(III) acetate hydrate, 99.9% (Metals basis) CAS:304675-64-7 Package:1g Remarks:A18271
|
|
| | SCANDIUM ACETATE Basic information |
| | SCANDIUM ACETATE Chemical Properties |
| form | powder, crystals or chunks | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | InChI | 1S/3C2H4O2.H2O.Sc/c3*1-2(3)4;;/h3*1H3,(H,3,4);1H2;/q;;;;+3/p-3 | | InChIKey | WAUFOVXMMKWBAE-UHFFFAOYSA-K | | SMILES | O.CC(=O)O[Sc](OC(C)=O)OC(C)=O |
| WGK Germany | 3 | | TSCA | Yes | | HS Code | 2915390090 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | SCANDIUM ACETATE Usage And Synthesis |
| Uses | Scandium(III) acetate hydrate is used as an organic chemical synthesis intermediate. | | reaction suitability | core: scandium reagent type: catalyst |
| | SCANDIUM ACETATE Preparation Products And Raw materials |
|