| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Benzaldehyde, 2-(2-methylphenoxy)- Basic information |
| | Benzaldehyde, 2-(2-methylphenoxy)- Chemical Properties |
| Melting point | 50 °C | | Boiling point | 310.7±25.0 °C(Predicted) | | density | 1.129±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C14H12O2/c1-11-6-2-4-8-13(11)16-14-9-5-3-7-12(14)10-15/h2-10H,1H3 | | InChIKey | HESGRRUYUHSXER-UHFFFAOYSA-N | | SMILES | O(c2c(cccc2)C)c1c(cccc1)C=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | Benzaldehyde, 2-(2-methylphenoxy)- Usage And Synthesis |
| | Benzaldehyde, 2-(2-methylphenoxy)- Preparation Products And Raw materials |
|