Phenol, 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxy- manufacturers
- Gigantol
-
- $87.00 / 1mg
-
2026-01-26
- CAS:83088-28-2
- Min. Order:
- Purity: 99.96%
- Supply Ability: 10g
|
| | Phenol, 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxy- Basic information |
| Product Name: | Phenol, 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxy- | | Synonyms: | Phenol, 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxy-;3',4-Dihydroxy-3,5'-dimethoxybibenzyl;4'-dihydroxy-5;5'-dimethoxybibenzyl;3,4'-dihydroxy-3,5'-dimethoxybibenzyl;3,4'-dihydroxy-5,5'-dimethoxybibenzyl;Gigantol(Dendrophenol), 10 mM in DMSO | | CAS: | 83088-28-2 | | MF: | C16H18O4 | | MW: | 274.31 | | EINECS: | | | Product Categories: | | | Mol File: | 83088-28-2.mol | ![Phenol, 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxy- Structure](CAS/20180601/GIF/83088-28-2.gif) |
| | Phenol, 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxy- Chemical Properties |
| Boiling point | 452.3±40.0 °C(Predicted) | | density | 1.204±0.06 g/cm3(Predicted) | | form | Oil | | pka | 9.63±0.10(Predicted) | | color | Colorless to light yellow | | InChI | InChI=1S/C16H18O4/c1-19-14-8-12(7-13(17)10-14)4-3-11-5-6-15(18)16(9-11)20-2/h5-10,17-18H,3-4H2,1-2H3 | | InChIKey | BMSPEISBKGSBTR-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(CCC2=CC(OC)=CC(O)=C2)C=C1OC |
| | Phenol, 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxy- Usage And Synthesis |
| Uses | Gigantol is a natural product that could be isolated from Cymbidium giganteum. Gigantol is a potent inhibitor of the spontaneous contractions of the guinea-pig ileum[1]. | | References | [1] R.K. Juneja, et, al. A substituted 1,2-diarylethane from Cymbidium giganteum. Phytochemistry. 1985 Feb 5;24(2): 321-4. |
| | Phenol, 4-[2-(3-hydroxy-5-methoxyphenyl)ethyl]-2-methoxy- Preparation Products And Raw materials |
|