| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:3,4-Dichlorobenzenesulfonyl fluoride
CAS:60191-50-6
Purity:95% Package:1G Remarks:ALD00138-1G
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:3,4-Dichlorobenzenesulfonyl fluoride 95%
CAS:60191-50-6
Purity:95% Package:10g;1g Remarks:NULL
|
| Company Name: |
Hangzhou Taorui Biotechnology Co., Ltd
|
| Tel: |
QQ1259737804 15268198094 |
| Email: |
sales@torreybio.com |
| Products Intro: |
Product Name:Benzenesulfonylfluoride,3,4-dichloro-
CAS:60191-50-6
Purity:95%+ Package:1g；5g；10g；
|
| Company Name: |
Zhengzhou Converging Chemical Co. LTD
|
| Tel: |
0371-53399770 18037166334 |
| Email: |
3857571523@qq.com |
| Products Intro: |
Product Name:3,4-Dichlorobenzene-1-sulfonyl fluoride
CAS:60191-50-6
Purity:95% Package:1g;5g;10g
|
|
| | Benzenesulfonylfluoride, 3,4-dichloro- Basic information |
| | Benzenesulfonylfluoride, 3,4-dichloro- Chemical Properties |
| density | 1.587 g/mL at 25 °C | | refractive index | n20/D 1.539 | | InChI | 1S/C6H3Cl2FO2S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3H | | InChIKey | MEUGNSGWAGTVDJ-UHFFFAOYSA-N | | SMILES | FS(C1=CC=C(Cl)C(Cl)=C1)(=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Benzenesulfonylfluoride, 3,4-dichloro- Usage And Synthesis |
| Uses | Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers. | | reaction suitability | reaction type: click chemistry |
| | Benzenesulfonylfluoride, 3,4-dichloro- Preparation Products And Raw materials |
|