| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | N,N-Dimethylacetamide-d9 Basic information |
| Product Name: | N,N-Dimethylacetamide-d9 | | Synonyms: | Dimethylacet amide-d9;N,N-Bis[(2H3)methyl](2,2,2-2H3)acetamide;N,N-Di[(2H3)methyl](2,2,2-2H3)acetamide;N,N-Dimethylacetamide-D9 99.0 Atom % D;N,N-DIMETHYLACETAMIDE-D9 DEUTERATION DEG;forNMRspectroscopy,deuterationdegree;N,N-di(methyl-d3)-Acetamide-d3;N,N-Dimethylacetamide-d9 | | CAS: | 16727-10-9 | | MF: | C4D9NO | | MW: | 96.18 | | EINECS: | | | Product Categories: | | | Mol File: | 16727-10-9.mol |  |
| | N,N-Dimethylacetamide-d9 Chemical Properties |
| Melting point | -20°C (lit.) | | density | 1.033 g/mL at 25 °C | | vapor pressure | 1.76 hPa (20 °C) | | refractive index | n20/D 1.438(lit.) | | Fp | 70°C | | storage temp. | Store below +30°C. | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colorless to light yellow | | explosive limit | 1.7-11.5%(V) | | Boiling point | 165-166°C (1013 hPa) | | InChI | 1S/C4H9NO/c1-4(6)5(2)3/h1-3H3/i1D3,2D3,3D3 | | InChIKey | FXHOOIRPVKKKFG-GQALSZNTSA-N | | SMILES | O=C(N(C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] | | CAS Number Unlabeled | 127-19-5 |
| WGK Germany | 3 | | Autoignition Temperature | 400 °C | | HS Code | 2845 90 10 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Eye Irrit. 2
Repr. 1B | | Toxicity | LD50 orally in Rabbit: 5830 mg/kg LD50 dermal Rabbit 2240 mg/kg |
| Provider | Language |
|
ALFA
| English |
| | N,N-Dimethylacetamide-d9 Usage And Synthesis |
| Uses | N,N-Dimethylacetamide (D9, 99%) was useful in the manufacturing of hollow fiber solid oxide fuel cell with petal-like cross section. |
| | N,N-Dimethylacetamide-d9 Preparation Products And Raw materials |
|