- Fmoc-L-Asn-OH
-
- $0.00/ kg
-
2026-01-30
- CAS:71989-16-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-Asn-OH
-
- $0.00 / 1Box
-
2026-01-04
- CAS:71989-16-7
- Min. Order: 1Box
- Purity: 99%
- Supply Ability: 200kg
|
| | Nalpha-FMOC-L-Asparagine Basic information |
| | Nalpha-FMOC-L-Asparagine Chemical Properties |
| Melting point | 190 °C (dec.)(lit.) | | alpha | -13 º (c=1,DMF) | | Boiling point | 487.59°C (rough estimate) | | density | 1.3354 (rough estimate) | | refractive index | -13 ° (C=1, DMF) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in water or 1% acetic acid | | pka | 3.68±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | -11..88°(C=0.01g/mI, DMF, 20°C, 589nm) | | BRN | 4335103 | | Major Application | peptide synthesis | | InChI | 1S/C19H18N2O5/c20-17(22)9-16(18(23)24)21-19(25)26-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H2,20,22)(H,21,25)(H,23,24) | | InChIKey | YUGBZNJSGOBFOV-UHFFFAOYSA-N | | SMILES | N(C(CC(=O)N)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 | | CAS DataBase Reference | 71989-16-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36/37/39-27-26 | | WGK Germany | 3 | | F | 21 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Nalpha-FMOC-L-Asparagine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Nα-Fmoc-L-asparagine is an N-Fmoc-protected form of L-Asparagine (A790005). L-Asparagine was first isolated by Robiquet and Vauquelin from asparagus juice (a high source of L-asparagine). L-Asparagine is often incorporated into proteins, and is a basis for some cancer therapies as certain cancerous cells require L-asparagine for growth. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Nalpha-FMOC-L-Asparagine Preparation Products And Raw materials |
|