|
|
| | FMOC-21-AMINO-4,7,10,13,16,19-HEXAOXAHENEICOSANOIC ACID Basic information |
| Product Name: | FMOC-21-AMINO-4,7,10,13,16,19-HEXAOXAHENEICOSANOIC ACID | | Synonyms: | FMoc-PEG6-CH2CH2COOH;Fmoc-N-amido-PEG6-acid;Fmoc-N-amido-PEG7-acid;Fmoc-PEG6-propionic acid;Fmoc-NH-(PEG)6-CH2CH2COOH;FMOC-21-AMINO-4,7,10,13,16,19-HEXAOXAHENEICOSANOIC ACID;FMoc-21-aMino-4,7,10,13,16,19-hexaoxaheneicosanoic;21-(Fmoc-amino)-4,7,10,13,16,19-hexaoxahenicosanoic Acid | | CAS: | 882847-34-9 | | MF: | C30H41NO10 | | MW: | 575.65 | | EINECS: | | | Product Categories: | peg | | Mol File: | 882847-34-9.mol |  |
| | FMOC-21-AMINO-4,7,10,13,16,19-HEXAOXAHENEICOSANOIC ACID Chemical Properties |
| Boiling point | 734.8±60.0 °C(Predicted) | | density | 1.202±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 4.28±0.10(Predicted) | | form | Oil | | color | Colourless | | Major Application | peptide synthesis | | InChIKey | HEGZERUHBVYZPH-UHFFFAOYSA-N | | SMILES | C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)NCCOCCOCCOCCOCCOCCOCCC(O)=O |
| WGK Germany | WGK 2 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | FMOC-21-AMINO-4,7,10,13,16,19-HEXAOXAHENEICOSANOIC ACID Usage And Synthesis |
| Description | Fmoc-N-amido-PEG6-acid is a PEG linker containing an Fmoc-protected amine and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Chemical Properties | Yellowish oil | | Uses | (Fmoc-amino)-PEG6-carboxylic acid (CAS# 882847-34-9) is a useful building block used in the preparation of cyclic megamolecules, and in L- and D-oligopeptides with circularly polarized luminescence. | | reaction suitability | reaction type: Pegylations | | IC 50 | Cleavable Linker; PEGs |
| | FMOC-21-AMINO-4,7,10,13,16,19-HEXAOXAHENEICOSANOIC ACID Preparation Products And Raw materials |
|