(R)-tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate manufacturers
|
| | (R)-tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate Basic information |
| Product Name: | (R)-tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate | | Synonyms: | (R)-tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate;1-Piperidinecarboxylic acid, 4-amino-3,3-difluoro-, 1,1-dimethylethyl ester, (4R)-;tert-butyl (4R)-4-amino-3,3-difluoropiperidine-1-carboxylate;(R)-4-amino-1-Boc-3,3-difluoro-piperidine;(R)-1-Boc-3,3-difluoropiperidin-4-amine;(4R)-1-Boc-4-amino-3,3-difluoropiperidine ee;(R)-Boc-4-NH2-3,3-difluoropiperidin;1,1-Dimethylethyl (4R)-4-amino-3,3-difluoro-1-piperidinecarboxylate | | CAS: | 1820679-70-6 | | MF: | C10H18F2N2O2 | | MW: | 236.26 | | EINECS: | | | Product Categories: | | | Mol File: | 1820679-70-6.mol |  |
| | (R)-tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate Chemical Properties |
| Boiling point | 281.5±40.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 7.66±0.40(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C10H18F2N2O2/c1-9(2,3)16-8(15)14-5-4-7(13)10(11,12)6-14/h7H,4-6,13H2,1-3H3/t7-/m1/s1 | | InChIKey | APZOOTJWPGQYSZ-SSDOTTSWSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC[C@@H](N)C(F)(F)C1 |
| | (R)-tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate Usage And Synthesis |
| | (R)-tert-butyl 4-amino-3,3-difluoropiperidine-1-carboxylate Preparation Products And Raw materials |
|