| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
|
| | Obeticholic Impurity 12 Basic information |
| Product Name: | Obeticholic Impurity 12 | | Synonyms: | Obeticholic Acid impurity 13/6-Ethylidene-Obeticholic Acid/(3α,5β,6Z,7α)-6-Ethylidene-3,7-dihydroxy-cholan-24-oic Acid;Obeticholic Acid 6-Ethylidene;Obeticholic Acid Impurity 47;(R)-4-((3R,5R,7S,8S,9S,10R,13R,14S,17R,Z)-6-Ethylidene-3,7-dihydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic Acid;Cholan-24-oic acid, 6-ethylidene-3,7-dihydroxy-, (3α,5β,6Z,7α)-;Obeticholic Acid Impurity 31;3 alpha-hydroxy-6-ethylidee-7 keto-5 beta cholanoic acid | | CAS: | 1885104-64-2 | | MF: | C26H42O4 | | MW: | 418.62 | | EINECS: | | | Product Categories: | | | Mol File: | 1885104-64-2.mol |  |
| | Obeticholic Impurity 12 Chemical Properties |
| Boiling point | 570.7±40.0 °C(Predicted) | | density | 1.146±0.06 g/cm3(Predicted) | | pka | 4.76±0.10(Predicted) | | InChIKey | NJXXWLPIJNFPHG-IWCJPLIPNA-N | | SMILES | C[C@]12CC[C@@H](O)C[C@@]1([H])/C(=C/C)/[C@@H](O)[C@@]1([H])[C@]3([H])CC[C@]([H])([C@H](C)CCC(=O)O)[C@@]3(C)CC[C@]21[H] |&1:1,4,7,12,14,16,20,22,29,33,r| |
| | Obeticholic Impurity 12 Usage And Synthesis |
| Uses | 6-epi-Obeticholic Acid is obtained from Nutriacholic Acid Methyl Ester (N925555) which is the methyl ester of Nutriacholic Acid (N925550), a derivative of Lithocholic Acid (L469180). The Lithocholic Acid (L469180) is a cholic acid derivative as TGR5 modulator. Impurity in the synthesis of Obeticholic Acid (E899810). |
| | Obeticholic Impurity 12 Preparation Products And Raw materials |
|