- STRONTIUM ACETATE
-
- $10.00 / 1KG
-
2026-01-30
- CAS:543-94-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- STRONTIUM ACETATE
-
- $6.00 / 1kg
-
2025-07-29
- CAS:543-94-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000KG/Month
- Strontium acetate
-
- $10.00 / 25Kg/Drum
-
2025-06-20
- CAS:14692-29-6;543-94-2
- Min. Order: 25T
- Purity: 99%
- Supply Ability: 500tons/month
|
| | STRONTIUM ACETATE Basic information |
| | STRONTIUM ACETATE Chemical Properties |
| Melting point | 150°C -0.5H₂O | | density | 2,099 g/cm3 | | vapor pressure | 0Pa at 20℃ | | solubility | very soluble in H2O | | form | Powder | | color | white | | Specific Gravity | 2.099 | | Water Solubility | soluble in 2.5 parts H2O; slightly soluble alcohol [MER06] | | Sensitive | Hygroscopic | | Merck | 14,8836 | | BRN | 3692534 | | Cosmetics Ingredients Functions | ORAL CARE SOOTHING | | InChI | InChI=1S/2C2H4O2.Sr/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 | | InChIKey | RXSHXLOMRZJCLB-UHFFFAOYSA-L | | SMILES | [Sr+2].C([O-])(=O)C.C([O-])(=O)C | | LogP | -0.58 at 20℃ | | CAS DataBase Reference | 543-94-2(CAS DataBase Reference) | | EPA Substance Registry System | Acetic acid, strontium salt (543-94-2) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | AJ4725000 | | F | 3-10 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | STRONTIUM ACETATE Usage And Synthesis |
| Chemical Properties | White, crystalline powder. Soluble in
water; loses 1/2H2O at 150C. | | Uses | Strontium acetate is used in manufacture of Laboratory Reagent, Dental toothpaste, catalysts, chemical intermediates, medicines etc. | | Uses | Precursor to promising candidate materials for superconductor wire. | | Production Methods | Strontium acetate, white crystals, soluble, formed by reaction of strontium carbonate or hydroxide and acetic acid. | | Flammability and Explosibility | Not classified | | reaction suitability | core: strontium | | Purification Methods | Crystallise it from AcOH, then dry it under vacuum for 24hours at 100o. [Beilstein 2 II 91.] |
| | STRONTIUM ACETATE Preparation Products And Raw materials |
|