| 
                    
                    1,1-diphenyl-2,2-di(p-bromophenyl)ethylene manufacturers | |  |  | 1,1-diphenyl-2,2-di(p-bromophenyl)ethylene Basic information | 
 | Product Name: | 1,1-diphenyl-2,2-di(p-bromophenyl)ethylene |  | Synonyms: | 1,1-diphenyl-2,2-di(p-bromophenyl)ethylene;1-bromo-4-(1-(4-bromophenyl)-2,2-diphenylvinyl)benzene;Benzene, 1,1'-(2,2-diphenylethenylidene)bis[4-bromo-;1,1-diphenyl-2, 2-di(4-bromophenyl) ethylene;4,4'-(2,2-Diphenylethene-1,1-diyl)bis(bromobenzene);1-bromo-4-[1-(4-bromophenyl)-2,2-diphenylethenyl]benzene;4,4'-(2,2-Diphenylethene-1,1-diyl)bis(bromobenzene) |  | CAS: | 859315-37-0 |  | MF: | C26H18Br2 |  | MW: | 490.23 |  | EINECS: |  |  | Product Categories: |  |  | Mol File: | 859315-37-0.mol |  |  | 
|  |  | 1,1-diphenyl-2,2-di(p-bromophenyl)ethylene Chemical Properties | 
 | Melting point | 205 °C |  | Boiling point | 500.1±45.0 °C(Predicted) |  | density | 1.450±0.06 g/cm3(Predicted) |  | storage temp. | Storage temp. 2-8°C |  | Appearance | White to off-white Solid |  | InChI | InChI=1S/C26H18Br2/c27-23-15-11-21(12-16-23)26(22-13-17-24(28)18-14-22)25(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-18H |  | InChIKey | LUSFLSAYXQSMPB-UHFFFAOYSA-N |  | SMILES | C(/C1=CC=C(Br)C=C1)(\C1=CC=C(Br)C=C1)=C(\C1=CC=CC=C1)/C1=CC=CC=C1 | 
|  |  | 1,1-diphenyl-2,2-di(p-bromophenyl)ethylene Usage And Synthesis | 
|  |  | 1,1-diphenyl-2,2-di(p-bromophenyl)ethylene Preparation Products And Raw materials | 
                 |