1,1-diphenyl-2,2-di(p-bromophenyl)ethylene manufacturers
|
| | 1,1-diphenyl-2,2-di(p-bromophenyl)ethylene Basic information |
| Product Name: | 1,1-diphenyl-2,2-di(p-bromophenyl)ethylene | | Synonyms: | 1,1-diphenyl-2,2-di(p-bromophenyl)ethylene;1-bromo-4-(1-(4-bromophenyl)-2,2-diphenylvinyl)benzene;Benzene, 1,1'-(2,2-diphenylethenylidene)bis[4-bromo-;1,1-diphenyl-2, 2-di(4-bromophenyl) ethylene;4,4'-(2,2-Diphenylethene-1,1-diyl)bis(bromobenzene);1-bromo-4-[1-(4-bromophenyl)-2,2-diphenylethenyl]benzene;4,4'-(2,2-Diphenylethene-1,1-diyl)bis(bromobenzene) | | CAS: | 859315-37-0 | | MF: | C26H18Br2 | | MW: | 490.23 | | EINECS: | | | Product Categories: | | | Mol File: | 859315-37-0.mol |  |
| | 1,1-diphenyl-2,2-di(p-bromophenyl)ethylene Chemical Properties |
| Melting point | 205 °C | | Boiling point | 500.1±45.0 °C(Predicted) | | density | 1.450±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C26H18Br2/c27-23-15-11-21(12-16-23)26(22-13-17-24(28)18-14-22)25(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-18H | | InChIKey | LUSFLSAYXQSMPB-UHFFFAOYSA-N | | SMILES | C(/C1=CC=C(Br)C=C1)(\C1=CC=C(Br)C=C1)=C(\C1=CC=CC=C1)/C1=CC=CC=C1 |
| | 1,1-diphenyl-2,2-di(p-bromophenyl)ethylene Usage And Synthesis |
| | 1,1-diphenyl-2,2-di(p-bromophenyl)ethylene Preparation Products And Raw materials |
|