| Company Name: |
LaaJoo |
| Tel: |
021-60702684 18516024827 |
| Email: |
huang.jiayi@sinocompound.com |
|
| | (2R,2'R,3R,3'R) MeO-BIBOP Basic information |
| Product Name: | (2R,2'R,3R,3'R) MeO-BIBOP | | Synonyms: | (2R,2'R,3R,3'R) MeO-BIBOP;(2R,2'R,3R,3'R)-3,3'-di-tert-butyl-4,4'-dimethoxy-2,2',3,3'-tetrahydro-2,2'-bibenzo[d][1,3]oxaphosphole;(2R,2'R,3R,3'R)-3,3'-Bis(tert-butyl)-2,2',3,3'-tetrahydro-4,4'-dimethoxy-2,2'-bi-1,3-benzoxaphosphole;(2R,2'R,3R,3'R)-3,3'-Di-tert-butyl-4,4'-dimethoxy-2,2',3,3'-tetrahydro-2,2'-bibenzo[d][1,3]oxaphosphole, 97% (>99% ee) (2R,2'R,3R,3'R)-MeO-BIBOP;ZJ-0048;99% ee) (2R,2'R,3R,3'R)-MeO-BIBOP;(2R,2'R,3R,3'R)-3,3'-Di-tert-butyl-4,4'-dimethoxy-2,2',3,3'-tetrahydro-2,2'-bibenzo[d][1,3]oxaphosphole, 97% (>;2,2'-Bi-1,3-benzoxaphosphole, 3,3'-bis(1,1-dimethylethyl)-2,2',3,3'-tetrahydro-4,4'-dimethoxy-, (2R,2'R,3R,3'R)- | | CAS: | 1228758-57-3 | | MF: | C24H32O4P2 | | MW: | 446.46 | | EINECS: | | | Product Categories: | | | Mol File: | 1228758-57-3.mol |  |
| | (2R,2'R,3R,3'R) MeO-BIBOP Chemical Properties |
| Boiling point | 562.3±50.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | Appearance | White to off-white Solid | | InChI | InChI=1S/C24H32O4P2/c1-23(2,3)29-19-15(25-7)11-9-13-17(19)27-21(29)22-28-18-14-10-12-16(26-8)20(18)30(22)24(4,5)6/h9-14,21-22H,1-8H3/t21-,22-,29-,30-/m1/s1 | | InChIKey | KVPCVNGTJXEQKH-IKTNGCAPSA-N | | SMILES | O1C2=CC=CC(OC)=C2[P@@](C(C)(C)C)[C@@H]1[C@H]1[P@](C(C)(C)C)C2=C(OC)C=CC=C2O1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (2R,2'R,3R,3'R) MeO-BIBOP Usage And Synthesis |
| Uses | (2R,2′R,3R,3′R)-MeO-BIBOP is a P-chiral biphosphorus ligand used in a variety of asymmetric transition metal-catalyzed transformations including hydrogenations, propargylations, reductions, and hydroformylations.
Product can be used with our benchtop hydrogen generator, H-Genie Lite (Z744083) | | reaction suitability | reagent type: ligand |
| | (2R,2'R,3R,3'R) MeO-BIBOP Preparation Products And Raw materials |
|