| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | Biotin-dPEG(R)3-benzophenone Basic information |
| Product Name: | Biotin-dPEG(R)3-benzophenone | | Synonyms: | Biotin-dPEG(R)3-benzophenone;1H-Thieno[3,4-d]imidazole-4-pentanamide, N-[1-(4-benzoylphenyl)-1-oxo-6,9,12-trioxa-2-azapentadec-15-yl]hexahydro-2-oxo-, (3aS,4S,6aR)-;N1-Biotinyl-N13-(4-Benzoylbenzoyl)-4,7,10-trioxa-1,13-tridecanediamine;Biotin-dPEG?3-benzophenone;Biotin-PEG3-benzophenone | | CAS: | 756525-96-9 | | MF: | C34H46N4O7S | | MW: | 654.82 | | EINECS: | | | Product Categories: | | | Mol File: | 756525-96-9.mol |  |
| | Biotin-dPEG(R)3-benzophenone Chemical Properties |
| Boiling point | 933.5±65.0 °C(Predicted) | | density | 1.188±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | solid or viscous liquid | | pka | 13.90±0.40(Predicted) | | color | Off-white to light yellow | | SMILES | O=C(NCCCOCCOCCOCCCNC(C1=CC=C(C=C1)C(C2=CC=CC=C2)=O)=O)CCCCC3C4NC(NC4CS3)=O |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | Biotin-dPEG(R)3-benzophenone Usage And Synthesis |
| Uses | Biotin-PEG3-benzophenone is biotin-labeled Benzophenone (HY-Y0546). Benzophenone is an endogenous metabolite and a photosensitizer that has been implicated in photosensitive damage to DNA. Benzophenone causes nucleobase oxidation, formation of cyclobutane-pyrimidine dimers, single-strand breaks, DNA-protein cross-links or abasic sites, different pathologies that may occur in nucleosides, oligonucleotides or DNA [1]. | | reaction suitability | reagent type: cross-linking reagent | | References | [1] Cuquerella MC, Lhiaubet-Vallet V, Cadet J, Miranda MA. Benzophenone photosensitized DNA damage. Acc Chem Res. 2012 Sep 18;45(9):1558-70. DOI:10.1021/ar300054e |
| | Biotin-dPEG(R)3-benzophenone Preparation Products And Raw materials |
|