|
|
| | 1-Boc-4-piperidylacetic acid Basic information |
| | 1-Boc-4-piperidylacetic acid Chemical Properties |
| Melting point | 96-98°C | | Boiling point | 373.0±15.0 °C(Predicted) | | density | 1.121±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 4.66±0.10(Predicted) | | form | Powder, Solid or Crystalline Powder | | color | Yellow to brown | | BRN | 7028968 | | InChI | InChI=1S/C12H21NO4/c1-12(2,3)17-11(16)13-6-4-9(5-7-13)8-10(14)15/h9H,4-8H2,1-3H3,(H,14,15) | | InChIKey | ZXFLMSIMHISJFV-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(CC(O)=O)CC1 | | CAS DataBase Reference | 157688-46-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 |
| | 1-Boc-4-piperidylacetic acid Usage And Synthesis |
| Chemical Properties | Solid | | Uses | 1-Boc-4-piperidylacetic acid is a pharmaceutical intermediate compound used in the preparation of drugs such as Lonafarnib or Tirofiban hydrochloride.Lonafarnib is a potent farnesyltransferase inhibitor used to reduce the mortality rate associated with Hutchinson-Guilford premature aging syndrome (HGPS) ) and other classes of progeria-related mortality. And Tirofiban hydrochloride is an antiplatelet drug. |
| | 1-Boc-4-piperidylacetic acid Preparation Products And Raw materials |
|