|
|
| | 4-(DIETHOXYMETHYL)BENZALDEHYDE Basic information |
| | 4-(DIETHOXYMETHYL)BENZALDEHYDE Chemical Properties |
| Boiling point | 89-93 °C (7 mmHg) | | density | 1.047 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.506(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | liquid (clear) | | color | clear deep yellow | | Water Solubility | soluble in alcohol, chlorinated solvents and toluene. Decomposes in water. | | Sensitive | Air Sensitive | | BRN | 4293872 | | InChI | InChI=1S/C12H16O3/c1-3-14-12(15-4-2)11-7-5-10(9-13)6-8-11/h5-9,12H,3-4H2,1-2H3 | | InChIKey | HTMXMFARWHNJDW-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(C(OCC)OCC)C=C1 | | CAS DataBase Reference | 81172-89-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | F | 1-10 | | Hazard Note | Irritant | | HS Code | 29124900 | | Storage Class | 10 - Combustible liquids |
| | 4-(DIETHOXYMETHYL)BENZALDEHYDE Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid | | Uses | 4-(Diethoxymethyl)benzaldehyde was used in the synthesis of 4-(diethoxymethyl)benzyl alcohol. | | Synthesis | A mixed solution of terephthalaldehyde (10 g, 74.55 mmol) and ammonium chloride (160 mg, 3.0 mmol) in ethanol (10.3 g, 223.6 mmol) was added slowly and dropwise to the reaction flask at 0 °C. Subsequently, triethyl orthoformate (12.15 g, 82 mmol) was added dropwise to the reaction system. The reaction mixture was stirred at room temperature overnight. Upon completion of the reaction, the mixture was concentrated and the residue was purified by silica gel column chromatography to afford the target product terephthalaldehyde diethyl acetal (7.0 g, 50% yield) as a white solid.LC-MS (ESI) m/z: 209 (M + 1)+. | | References | [1] Patent: US2010/35883, 2010, A1. Location in patent: Page/Page column 91
[2] Patent: WO2011/130661, 2011, A1. Location in patent: Page/Page column 178
[3] Journal of Enzyme Inhibition and Medicinal Chemistry, 2019, vol. 34, # 1, p. 204 - 218 |
| | 4-(DIETHOXYMETHYL)BENZALDEHYDE Preparation Products And Raw materials |
|