| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | tert-Butyl 2-oxo-3-(trifluoromethyl)piperidin-3-ylcarbamate Basic information |
| Product Name: | tert-Butyl 2-oxo-3-(trifluoromethyl)piperidin-3-ylcarbamate | | Synonyms: | tert-butyl N-[2-oxo-3-(trifluoromethyl)piperidin-3-yl]carbamate;Carbamic acid, [2-oxo-3-(trifluoromethyl)-3-piperidinyl]-,1,1-dimethylethyl ester;tert-butyl N-[2-oxo-3-(trifluoromethyl)-3-piperidyl]carbamate;Carbamic acid, N-[2-oxo-3-(trifluoromethyl)-3-piperidinyl]-, 1,1-dimethylethyl ester;tert-Butyl 2-oxo-3-(trifluoromethyl)piperidin-3-ylcarbamate | | CAS: | 195196-07-7 | | MF: | C11H17F3N2O3 | | MW: | 282.26 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | tert-Butyl 2-oxo-3-(trifluoromethyl)piperidin-3-ylcarbamate Chemical Properties |
| Boiling point | 390.6±42.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | form | solid | | pka | 8.40±0.20(Predicted) | | InChI | 1S/C11H17F3N2O3/c1-9(2,3)19-8(18)16-10(11(12,13)14)5-4-6-15-7(10)17/h4-6H2,1-3H3,(H,15,17)(H,16,18) | | InChIKey | NIUWIGGGPOVCFV-UHFFFAOYSA-N | | SMILES | O=C(OC(C)(C)C)NC1(C(NCCC1)=O)C(F)(F)F |
| Hazard Codes | Xi | | RIDADR | UN2811 | | Hazard Note | Irritant | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | tert-Butyl 2-oxo-3-(trifluoromethyl)piperidin-3-ylcarbamate Usage And Synthesis |
| | tert-Butyl 2-oxo-3-(trifluoromethyl)piperidin-3-ylcarbamate Preparation Products And Raw materials |
|