N,N-Bis-(5-chloro-pyridin-2-yl)-oxalamide manufacturers
|
| | N,N-Bis-(5-chloro-pyridin-2-yl)-oxalamide Basic information |
| Product Name: | N,N-Bis-(5-chloro-pyridin-2-yl)-oxalamide | | Synonyms: | N,N-Bis-(5-chloro-pyridin-2-yl)-oxalamide;N1,N2-bis(5-chloropyridin-2-yl)oxalamide;Ethanediamide, N1,N2-bis(5-chloro-2-pyridinyl)-;N1,N2-Bis(5-chloro-2-pyridinyl)ethanediamide;Edoxaban Impurity 61;Edoxaban Impurity 50;N1,N2-bis(5-chloropyridin-2-yl)oxalamideQ: What is
N1,N2-bis(5-chloropyridin-2-yl)oxalamide Q: What is the CAS Number of
N1,N2-bis(5-chloropyridin-2-yl)oxalamide;N1,N2-Bis(5-chloropyridin-2-yl)oxalamide (Edoxaban Impurity) | | CAS: | 349125-14-0 | | MF: | C12H8Cl2N4O2 | | MW: | 311.12 | | EINECS: | | | Product Categories: | | | Mol File: | 349125-14-0.mol |  |
| | N,N-Bis-(5-chloro-pyridin-2-yl)-oxalamide Chemical Properties |
| density | 1.605±0.06 g/cm3(Predicted) | | solubility | DMSO (Slightly) | | form | Solid | | pka | 8.46±0.70(Predicted) | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C12H8Cl2N4O2/c13-7-1-3-9(15-5-7)17-11(19)12(20)18-10-4-2-8(14)6-16-10/h1-6H,(H,15,17,19)(H,16,18,20) | | InChIKey | KLUDWSVPLPJUPR-UHFFFAOYSA-N | | SMILES | C(NC1=NC=C(Cl)C=C1)(=O)C(NC1=NC=C(Cl)C=C1)=O |
| | N,N-Bis-(5-chloro-pyridin-2-yl)-oxalamide Usage And Synthesis |
| Uses | N1,N2-Bis(5-chloro-2-pyridinyl) Ethanediamide is a useful research chemical used in the preparation of bis chloropyridin oxamide and purification of edoxaban toluenesulfonate. |
| | N,N-Bis-(5-chloro-pyridin-2-yl)-oxalamide Preparation Products And Raw materials |
|