|
|
| | Methyl beta-D-ribofuranoside Basic information |
| | Methyl beta-D-ribofuranoside Chemical Properties |
| Melting point | 78 °C | | Boiling point | 348.7±42.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | refractive index | -51 ° (C=2, H2O) | | storage temp. | Sealed in dry,2-8°C | | solubility | Methanol (Slightly), Water (Slightly, Sonicated) | | form | Powder | | pka | 13.14±0.70(Predicted) | | color | White to Off-white | | Water Solubility | Soluble in water | | InChI | InChI=1/C6H12O5/c1-10-6-5(9)4(8)3(2-7)11-6/h3-9H,2H2,1H3/t3-,4-,5-,6-/s3 | | InChIKey | NALRCAPFICWVAQ-QNEKUJPYNA-N | | SMILES | [C@H]1(CO)O[C@@H](OC)[C@H](O)[C@@H]1O |&1:0,4,7,9,r| | | CAS DataBase Reference | 7473-45-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29329990 |
| | Methyl beta-D-ribofuranoside Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | D-Ribose was converted into methyl 5-O-benzyl-beta-D-ribofuranoside and this, on tin-mediated allylation, gave a mixture of the 2-O-allyl and 3-O-allyl derivatives which were separated by chromatography. |
| | Methyl beta-D-ribofuranoside Preparation Products And Raw materials |
|