Sodium 1-hexanesulfonate monohydrate manufacturers
|
| | Sodium 1-hexanesulfonate monohydrate Basic information |
| | Sodium 1-hexanesulfonate monohydrate Chemical Properties |
| Melting point | >300°C | | storage temp. | Inert atmosphere,Room Temperature | | Colour Index | 73015 | | form | Crystalline Flakes or Solid | | color | White | | Water Solubility | Slightly soluble in water | | λmax | λ: 210 nm Amax: 0.1 λ: 220 nm Amax: 0.06 λ: 230 nm Amax: 0.04 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 | | BRN | 3727014 | | InChI | InChI=1S/C6H14O3S.Na.H2O.H/c1-2-3-4-5-6-10(7,8)9;;;/h2-6H2,1H3,(H,7,8,9);;1H2; | | InChIKey | VKJOCUWMRVSKEE-UHFFFAOYSA-N | | SMILES | C(CCCC)CS(O)(=O)=O.[NaH].O |
| WGK Germany | 3 | | TSCA | Yes | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids |
| | Sodium 1-hexanesulfonate monohydrate Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Sodium 1-hexanesulfonate monohydrate is an ion pair reagent, which is used for the analysis of small organic compounds, pharmaceutical products and metabolites using high-performance liquid chromatography (HPLC). It is an efficient catalyst for the preparation of alpha-aminophosphonates by the coupling of aldehydes/ketone, an amine and triethyl phosphate. |
| | Sodium 1-hexanesulfonate monohydrate Preparation Products And Raw materials |
|