|
|
| | 6-(2,6-Dimethylmorpholino)nicotinaldehyde Basic information |
| | 6-(2,6-Dimethylmorpholino)nicotinaldehyde Chemical Properties |
| Boiling point | 393.5±42.0 °C(Predicted) | | density | 1.114±0.06 g/cm3(Predicted) | | pka | 3.62±0.24(Predicted) | | form | solid | | InChI | 1S/C12H16N2O2/c1-9-6-14(7-10(2)16-9)12-4-3-11(8-15)5-13-12/h3-5,8-10H,6-7H2,1-2H3 | | InChIKey | QJKIFMOLBXODKC-UHFFFAOYSA-N | | SMILES | O=C([H])C1=CN=C(C=C1)N2CC(OC(C)C2)C |
| HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 6-(2,6-Dimethylmorpholino)nicotinaldehyde Usage And Synthesis |
| | 6-(2,6-Dimethylmorpholino)nicotinaldehyde Preparation Products And Raw materials |
|