|
|
| | ethyl 5-(4-methoxyphenyl)-1H-pyrazole-4-carboxylate Basic information |
| | ethyl 5-(4-methoxyphenyl)-1H-pyrazole-4-carboxylate Chemical Properties |
| Boiling point | 457.5±40.0 °C(Predicted) | | density | 1.203±0.06 g/cm3(Predicted) | | form | solid | | pka | 11.30±0.50(Predicted) | | InChI | 1S/C13H14N2O3/c1-3-18-13(16)11-8-14-15-12(11)9-4-6-10(17-2)7-5-9/h4-8H,3H2,1-2H3,(H,14,15) | | InChIKey | KYTLTMIUNGPXPA-UHFFFAOYSA-N | | SMILES | CCOC(C1=CNN=C1C2=CC=C(OC)C=C2)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 1 Eye Irrit. 2 |
| | ethyl 5-(4-methoxyphenyl)-1H-pyrazole-4-carboxylate Usage And Synthesis |
| | ethyl 5-(4-methoxyphenyl)-1H-pyrazole-4-carboxylate Preparation Products And Raw materials |
|