| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
| Company Name: |
HBCChem, Inc. |
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
| Company Name: |
TCI Chemicals |
| Tel: |
021-67121386, 800-988-0390 |
| Email: |
Sales-CN@TCIchemicals.com |
|
| | 3-(4-Nitrophenyl)isoxazole Basic information |
| | 3-(4-Nitrophenyl)isoxazole Chemical Properties |
| Melting point | 184 °C | | form | solid | | InChI | 1S/C9H6N2O3/c12-11(13)8-3-1-7(2-4-8)9-5-6-14-10-9/h1-6H | | InChIKey | XXAAKZGOIOIOQB-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(cc1)-c2ccon2 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | HS Code | 2934.99.9001 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-(4-Nitrophenyl)isoxazole Usage And Synthesis |
| | 3-(4-Nitrophenyl)isoxazole Preparation Products And Raw materials |
|