|
|
| | 3-Amino-4-methylbenzamide Basic information |
| | 3-Amino-4-methylbenzamide Chemical Properties |
| Melting point | 127-131 °C(lit.) | | Boiling point | 271.72°C (rough estimate) | | density | 1.1392 (rough estimate) | | vapor pressure | 0.001-0.001Pa at 25℃ | | refractive index | 1.6180 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Crystalline Chunks | | pka | 16.47±0.50(Predicted) | | color | Light brown | | Sensitive | Air Sensitive | | InChI | InChI=1S/C8H10N2O/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,9H2,1H3,(H2,10,11) | | InChIKey | VYBKAZXQKUFAHG-UHFFFAOYSA-N | | SMILES | C1(C=C(N)C(C)=CC=1)C(=O)N | | LogP | -0.2 at 23℃ and pH7.9 | | CAS DataBase Reference | 19406-86-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzamide, 3-amino-4-methyl- (19406-86-1) |
| | 3-Amino-4-methylbenzamide Usage And Synthesis |
| Chemical Properties | light brown crystalline chunks | | Uses | 3-Amino-4-methylbenzamide is useful for preparing heteroaryl compounds ERK1/ERK2 inhibitors. |
| | 3-Amino-4-methylbenzamide Preparation Products And Raw materials |
|