| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Fluoro-3-(trifluoromethyl)phenol Basic information |
| | 4-Fluoro-3-(trifluoromethyl)phenol Chemical Properties |
| Melting point | 17 °C | | Boiling point | 84-86°C 15mm | | density | 1.145 | | refractive index | 1.45 | | Fp | 90°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 8.97±0.18(Predicted) | | form | powder to lump to clear liquid | | color | White or Colorless to Orange to Green | | BRN | 2098736 | | InChI | InChI=1S/C7H4F4O/c8-6-2-1-4(12)3-5(6)7(9,10)11/h1-3,12H | | InChIKey | DHPCRFYUUWAGAH-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(F)C(C(F)(F)F)=C1 | | CAS DataBase Reference | 61721-07-1(CAS DataBase Reference) |
| | 4-Fluoro-3-(trifluoromethyl)phenol Usage And Synthesis |
| Chemical Properties | Colorless to pale yellow liquid | | Uses | 4-Fluoro-3-trifluoromethylphenol |
| | 4-Fluoro-3-(trifluoromethyl)phenol Preparation Products And Raw materials |
|