|
|
| | 1,3,5-Trimethylpyrazole Basic information |
| Product Name: | 1,3,5-Trimethylpyrazole | | Synonyms: | 1,3,5-Trimethylpyrazole ,98%;1,3,5,-Trimethylpyrazole,99%;1,3,5-TriMethylpyrazole, 97+%;1,3,5-Trimethyl-1H-pyrazole98%;VITAS-BB TBB000655;1H-Pyrazole, 1,3,5-trimethyl-;Pyrazole, 1,3,5-trimethyl-;1,3,5-TRIMETHYL-1H-PYRAZOLE | | CAS: | 1072-91-9 | | MF: | C6H10N2 | | MW: | 110.16 | | EINECS: | 626-960-6 | | Product Categories: | Pyrazoles;Nucleotides and Nucleosides;Bases & Related Reagents;Nucleotides;Pyrazoles & Triazoles;Building Blocks;Heterocyclic Building Blocks;Pyrazoles & Triazoles | | Mol File: | 1072-91-9.mol |  |
| | 1,3,5-Trimethylpyrazole Chemical Properties |
| Melting point | 38-41 °C (lit.) | | Boiling point | 168-170 °C | | density | 0.93 | | refractive index | 1.4589 | | Fp | 93 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 3.30±0.10(Predicted) | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | λmax | 220nm(MeOH)(lit.) | | BRN | 110515 | | InChI | InChI=1S/C6H10N2/c1-5-4-6(2)8(3)7-5/h4H,1-3H3 | | InChIKey | HNOQAFMOBRWDKQ-UHFFFAOYSA-N | | SMILES | N1(C)C(C)=CC(C)=N1 | | CAS DataBase Reference | 1072-91-9(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3,5-Trimethylpyrazole(1072-91-9) |
| Hazard Codes | Xi,F | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 1325 4.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29331990 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Eye Irrit. 2
Flam. Sol. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,3,5-Trimethylpyrazole Usage And Synthesis |
| Chemical Properties | White Low-Mekting Solid | | Uses | 1,3,5-Trimethylpyrazole is a compound used for chemical synthesis[1]. | | Definition | ChEBI: 1,3,5-Trimethyl-1H-pyrazole is a member of pyrazoles. | | Synthesis Reference(s) | Canadian Journal of Chemistry, 71, p. 410, 1993 DOI: 10.1139/v93-060 | | References | [1] Li QB, et al. Design, Synthesis, and Biological Activities of Novel 1,3,5-Trimethylpyrazole-Containing Malonamide Derivatives. Molecules. 2019 Feb 3;24(3). DOI:10.3390/molecules24030562 |
| | 1,3,5-Trimethylpyrazole Preparation Products And Raw materials |
|