|
|
| | Chloridazon Basic information |
| Product Name: | Chloridazon | | Synonyms: | 1-fenyl-4-amino-5-chlor-6-pyridazinon;1-fenyl-4-amino-5-chlor-6-pyridazinon(czech);1-Phenyl-4-amino-5-chloro-6-oxo-(1H)pyridazine;1-phenyl-4-amino-5-chloropyridaz-6-one;1-phenyl-4-amino-5-chloropyridazin-6-one;1-phenyl-4-amino-5-chloropyridazone-6;1-phenyl-4-amino-5-chlorpyridaz-6-one;4-chloro-5-amino-2-phenyl-3(2H)-pyridazinone | | CAS: | 1698-60-8 | | MF: | C10H8ClN3O | | MW: | 221.64 | | EINECS: | 216-920-2 | | Product Categories: | Agro-Products;Pyridines, Pyrimidines, Purines and Pteredines;Polymers | | Mol File: | 1698-60-8.mol |  |
| | Chloridazon Chemical Properties |
| Melting point | 198-200°C | | Boiling point | 312.2±52.0 °C(Predicted) | | density | 1.4884 (rough estimate) | | refractive index | 1.5330 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Chloroform (Slightlly), DMSO (Sparingly), Methanol (Slightly) | | pka | 0.71±0.20(Predicted) | | form | Solid | | color | Pale-yellowish solid | | Water Solubility | 0.3g/L(20 ºC) | | BRN | 397241 | | InChI | InChI=1S/C10H8ClN3O/c11-9-8(12)6-13-14(10(9)15)7-4-2-1-3-5-7/h1-6H,12H2 | | InChIKey | WYKYKTKDBLFHCY-UHFFFAOYSA-N | | SMILES | C1(=O)N(C2=CC=CC=C2)N=CC(N)=C1Cl | | LogP | 1.140 | | CAS DataBase Reference | 1698-60-8(CAS DataBase Reference) | | EPA Substance Registry System | Pyrazon (1698-60-8) |
| Hazard Codes | Xi,N | | Risk Statements | 43-50/53 | | Safety Statements | 24-37-60-61 | | RIDADR | 3077 | | WGK Germany | 2 | | RTECS | UR6125000 | | TSCA | TSCA listed | | HS Code | 2933.99.8290 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Skin Sens. 1 | | Hazardous Substances Data | 1698-60-8(Hazardous Substances Data) | | Toxicity | LD50 orl-rat: 647 mg/kg FAATDF 7,299,86 |
| | Chloridazon Usage And Synthesis |
| Chemical Properties | Brown Solid | | Uses | Herbicide, active by perturbing cell membranes | | Definition | ChEBI: A pyridazinone that is pyridazin-3(2H)-one substituted by an amino group at position 5, a chloro group at position 4 and a phenyl group at position 2. | | Safety Profile | Moderately toxic by ingestion and intraperitoneal routes. A severe eye irritant. Experimental reproductive effects. Used as a preemergence and early post-emergence herbicide. When heated to decomposition it emits very toxic fumes of Cland NOx. |
| | Chloridazon Preparation Products And Raw materials |
|