- 1-Linoleoyl Glycerol
-
- $0.00 / 25KG
-
2025-12-01
- CAS:2277-28-3
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
- 1-MONOLINOLEIN
-
- $0.00 / 25kg
-
2025-12-01
- CAS:2277-28-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| | 1-MONOLINOLEIN Basic information |
| | 1-MONOLINOLEIN Chemical Properties |
| Melting point | 14-15 °C | | Boiling point | 485.0±40.0 °C(Predicted) | | density | 0.981±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 13.16±0.20(Predicted) | | form | liquid | | color | Colourless to Pale Yellow | | biological source | synthetic (organic) | | Stability: | Light Sensitive, Temperature Sensitive | | Cosmetics Ingredients Functions | SKIN CONDITIONING
SURFACTANT - EMULSIFYING
SKIN CONDITIONING - EMOLLIENT | | Cosmetic Ingredient Review (CIR) | 1-MONOLINOLEIN (2277-28-3) | | InChI | InChI=1S/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3/b7-6-,10-9- | | InChIKey | WECGLUPZRHILCT-HZJYTTRNSA-N | | SMILES | C(OCC(O)CO)(=O)CCCCCCC/C=C\C/C=C\CCCCC | | LogP | 6.273 (est) | | CAS DataBase Reference | 2277-28-3(CAS DataBase Reference) |
| WGK Germany | 1 | | Storage Class | 10 - Combustible liquids |
| | 1-MONOLINOLEIN Usage And Synthesis |
| Chemical Properties | Colourless Oil | | Uses | 1-Linoleyl glyceride as free-living amoeba control agent; also a biomarker of metabolic responses to hepatotoxicants and carcinogens. | | Uses | glyceryl linoleate is an emollient with moisturizing capabilities. It is synthetically produced from naturally derived ingredients. | | Definition | ChEBI: 1-monolinolein is a 1-monoglyceride that has octadecadienoyl (linoleoyl) as the acyl group. It has a role as a plant metabolite and an antiviral agent. It is functionally related to a linoleic acid. | | Biochem/physiol Actions | Monolinolein (1-Linoleoyl-rac-glycerol) is used in the development of pH-responsive lyotropic liquid crystals for controlled drug delivery. |
| | 1-MONOLINOLEIN Preparation Products And Raw materials |
|