|
|
| | 3-Bromonitrobenzene Basic information |
| | 3-Bromonitrobenzene Chemical Properties |
| Melting point | 51-54 °C | | Boiling point | 256 °C | | density | 1.704 | | refractive index | 1.6050 (estimate) | | Fp | 113 °C | | storage temp. | Refrigerator | | solubility | 10g/l | | form | Solid | | color | Off-White to Pale Yellow | | BRN | 2043212 | | Henry's Law Constant | 5.3×100 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) | | InChI | InChI=1S/C6H4BrNO2/c7-5-2-1-3-6(4-5)8(9)10/h1-4H | | InChIKey | FWIROFMBWVMWLB-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC([N+]([O-])=O)=C1 | | CAS DataBase Reference | 585-79-5(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-bromo-3-nitro-(585-79-5) | | EPA Substance Registry System | Benzene, 1-bromo-3-nitro- (585-79-5) |
| Provider | Language |
|
ACROS
| English |
| | 3-Bromonitrobenzene Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | Labelled glycerol kinase substrate specificity | | Synthesis Reference(s) | The Journal of Organic Chemistry, 46, p. 2169, 1981 DOI: 10.1021/jo00323a039 | | Purification Methods | Crystallise it twice from pet ether, using charcoal before the first crystallisation. [Beilstein 5 III 618, 5 IV 729.] |
| | 3-Bromonitrobenzene Preparation Products And Raw materials |
|