(S)-(+)-Phenylsuccinic acid manufacturers
|
| | (S)-(+)-Phenylsuccinic acid Basic information |
| | (S)-(+)-Phenylsuccinic acid Chemical Properties |
| Melting point | 173-176 °C | | Boiling point | 290.62°C (rough estimate) | | alpha | 168 º (c=1, acetone) | | density | 1.2534 (rough estimate) | | refractive index | 147.5 ° (C=2, EtOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | within almost transparency in Methanol | | pka | 3.60±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D +171±4°, c = 1% in acetone | | BRN | 2616723 | | InChI | InChI=1S/C10H10O4/c11-9(12)6-8(10(13)14)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12)(H,13,14)/t8-/m0/s1 | | InChIKey | LVFFZQQWIZURIO-QMMMGPOBSA-N | | SMILES | C(O)(=O)[C@H](C1=CC=CC=C1)CC(O)=O | | CAS DataBase Reference | 4036-30-0(CAS DataBase Reference) |
| | (S)-(+)-Phenylsuccinic acid Usage And Synthesis |
| Chemical Properties | almost white micro-crystalline powder | | Uses | (S)-(+)-Phenylsuccinic acid is an enantiomer of (R)-Phenylsuccinic acid that has been used for the asymmetric synthesis of amines, antihistamines, and other compounds.
|
| | (S)-(+)-Phenylsuccinic acid Preparation Products And Raw materials |
|