|
|
| | Methyl 3-methoxypropionate Basic information | | Preparation |
| | Methyl 3-methoxypropionate Chemical Properties |
| Boiling point | 142-143 °C (lit.) | | density | 1.009 g/mL at 25 °C (lit.) | | vapor pressure | 9.733-15.999hPa at 20-25℃ | | refractive index | n20/D 1.402(lit.) | | Fp | 118 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.013 (20℃) | | Water Solubility | 428.60g/L(25 ºC) | | BRN | 1744829 | | InChI | InChI=1S/C5H10O3/c1-7-4-3-5(6)8-2/h3-4H2,1-2H3 | | InChIKey | BDJSOPWXYLFTNW-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCOC | | LogP | 0.1 | | CAS DataBase Reference | 3852-09-3(CAS DataBase Reference) | | EPA Substance Registry System | Propanoic acid, 3-methoxy-, methyl ester (3852-09-3) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36-37/39 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | RTECS | UF5274000 | | TSCA | TSCA listed | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29189900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | Methyl 3-methoxypropionate Usage And Synthesis |
| Preparation | In a dry reaction flask, 0.2 mL of Na₂CO₃ (0.05 M aq.) was added to a solution of ethyl acrylate (0.5 mmol) and methanol (2.0 mmol). The resulting reaction mixture was stirred at room temperature for approximately 5 hours until the olefins were completely consumed. The reaction progress was monitored by thin-layer chromatography (TLC). After the reaction was complete, the reaction mixture was extracted three times with ethyl acetate (3 x 5 mL). The combined organic layers were washed with brine (10 mL) and dried over Na₂SO₄. The organic layers were filtered to remove the drying agent, and the resulting organic solvent was concentrated under vacuum. The crude product was purified by silica gel column chromatography (eluent: PE: EtOAc = 8:1) to obtain methyl 3-methoxypropionate. | | Chemical Properties | clear colorless liquid | | Uses | Methyl 3-methoxypropionate may be employed as acylation reagent for the lipase-catalyzed N-acylation of 1-phenylethanamine. It may be used in the synthesis of poly(2-hydroxylethyl 5-norbornene-2-carboxylate /t-butyl 5-norbornene-2-carboxylate /5-norbornene-2-carboxylic acid /maleic anhydride) resists. Lithographic performance of these resists was studied using ArF stepper. | | Synthesis Reference(s) | Journal of the American Chemical Society, 68, p. 544, 1946 DOI: 10.1021/ja01208a003 | | General Description | Methyl 3-methoxypropionate is an ester. |
| | Methyl 3-methoxypropionate Preparation Products And Raw materials |
|