|
|
| | 2-(METHYLTHIO)PYRIMIDIN-4-AMINE Basic information |
| | 2-(METHYLTHIO)PYRIMIDIN-4-AMINE Chemical Properties |
| Boiling point | 312.9±15.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 4.22±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | Sensitive | Stench | | InChI | InChI=1S/C5H7N3S/c1-9-5-7-3-2-4(6)8-5/h2-3H,1H3,(H2,6,7,8) | | InChIKey | HGGXLEAHOVIYKT-UHFFFAOYSA-N | | SMILES | C1(SC)=NC=CC(N)=N1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-37/38-41-43 | | Safety Statements | 26-36/37-39 | | WGK Germany | 3 | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 2-(METHYLTHIO)PYRIMIDIN-4-AMINE Usage And Synthesis |
| Chemical Properties | white solid | | Uses | 2-Methylsulfanylpyrimidin-4-amine is used for methoxylation to prepare pentafluorobenzyl derivatives. |
| | 2-(METHYLTHIO)PYRIMIDIN-4-AMINE Preparation Products And Raw materials |
|