1,5-DIMETHYL-2-PYRROLIDINONE manufacturers
- 1,5-Dimethyl-2-pyrrolidinone
-
- $15.00 / 1KG
-
2021-07-02
- CAS:5075-92-3
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 1,5-DIMETHYL-2-PYRROLIDINONE Basic information |
| | 1,5-DIMETHYL-2-PYRROLIDINONE Chemical Properties |
| Boiling point | 215-217 °C/743 mmHg (lit.) | | density | 0.982 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.465(lit.) | | Fp | 193 °F | | form | liquid | | pka | -0.35±0.40(Predicted) | | InChI | InChI=1S/C6H11NO/c1-5-3-4-6(8)7(5)2/h5H,3-4H2,1-2H3 | | InChIKey | FILVIKOEJGORQS-UHFFFAOYSA-N | | SMILES | N1(C)C(C)CCC1=O | | EPA Substance Registry System | 2-Pyrrolidinone, 1,5-dimethyl- (5075-92-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,5-DIMETHYL-2-PYRROLIDINONE Usage And Synthesis |
| | 1,5-DIMETHYL-2-PYRROLIDINONE Preparation Products And Raw materials |
|