|
| 2-(1,3-DIOXOLAN-2-YL)FURAN Basic information |
Product Name: | 2-(1,3-DIOXOLAN-2-YL)FURAN | Synonyms: | Furalane;FURFURAL ETHYLENE ACETAL;2-(1,3-DIOXOLAN-2-YL)FURAN;2-(2-FURYL)-1,3-DIOXOLANE;RARECHEM AL BP 0007;Furfural Ethylene Acetal
2-(2-Furyl)-1,3-dioxolane;2-Furfural ethylene glycol acetal;2-(furan-2-yl)-1,3-dioxolane | CAS: | 1708-41-4 | MF: | C7H8O3 | MW: | 140.14 | EINECS: | | Product Categories: | | Mol File: | 1708-41-4.mol |  |
| 2-(1,3-DIOXOLAN-2-YL)FURAN Chemical Properties |
Melting point | -41 °C | Boiling point | 76°C/1mmHg(lit.) | density | 1,2 g/cm3 | refractive index | 1.4840-1.4870 | storage temp. | -20°C | form | clear liquid | color | Colorless to Light orange to Yellow | InChI | InChI=1S/C7H8O3/c1-2-6(8-3-1)7-9-4-5-10-7/h1-3,7H,4-5H2 | InChIKey | FCACHSUJEMZCMK-UHFFFAOYSA-N | SMILES | O1CCOC1C1=CC=CO1 |
| 2-(1,3-DIOXOLAN-2-YL)FURAN Usage And Synthesis |
| 2-(1,3-DIOXOLAN-2-YL)FURAN Preparation Products And Raw materials |
|