|
|
| | 3,3',5,5'-Tetra-tert-butyldiphenoquinone Basic information |
| Product Name: | 3,3',5,5'-Tetra-tert-butyldiphenoquinone | | Synonyms: | 3,3',5,5'-tetra-tert-butyl-4,4'-dibenzoquinone;2,6-Bis(1,1-dimethylethyl)-4-3,5-bis(1,1-dimethylethyl)-4-oxo-2,5-cyclohexa-dien-1-ylidene-2,5-cyclohexadien-1-one;3,3'',5,5''-TETRA-TERT-BUTYLDIPHENOQUINONE, 98+%;2,6-BIS(1,1-DIMETHYLETHYL)-4-[3,5-BIS(1,1-DIMETHYLETHYL)-4-OXO-2,5-CYCLOHEXADIEN-1-YLIDENE]-2,5-CYCLOHEXADIEN-1-ONE;RARECHEM BW GC 0005;2,2',6,6'-Tetra-tert-butyldiphenylquinone;2,2',6,6'-Tetra-tert-butyl-Δ4,4'-bi[2,5-cyclohexadiene]-1,1'-dione;3,3',5,5'-Tetra-tert-butyl-Δ1,1'(4H,4'H)-bibenzene-4,4'-dione | | CAS: | 2455-14-3 | | MF: | C28H40O2 | | MW: | 408.62 | | EINECS: | 219-527-4 | | Product Categories: | Anthraquinones, Hydroquinones and Quinones;electronic;Benzoquinones, etc. (Charge Transfer Complexes);Charge Transfer Complexes for Organic Metals;Functional Materials | | Mol File: | 2455-14-3.mol |  |
| | 3,3',5,5'-Tetra-tert-butyldiphenoquinone Chemical Properties |
| Melting point | 242-244°C | | Boiling point | 492.6±45.0 °C(Predicted) | | density | 1.024±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Tetrahydrofuran | | form | powder to crystal | | color | Red to Dark blue to Black | | λmax | 418.5 to 420.0nm(THF + MeOH) | | BRN | 1916759 | | InChI | InChI=1S/C28H40O2/c1-25(2,3)19-13-17(14-20(23(19)29)26(4,5)6)18-15-21(27(7,8)9)24(30)22(16-18)28(10,11)12/h13-16H,1-12H3 | | InChIKey | GQIGHOCYKUBBOE-UHFFFAOYSA-N | | SMILES | C1(=O)C(C(C)(C)C)=C/C(=C2/C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C/2)/C=C1C(C)(C)C |
| Safety Statements | 22-24/25 | | HS Code | 2914699000 |
| Provider | Language |
|
ALFA
| English |
| | 3,3',5,5'-Tetra-tert-butyldiphenoquinone Usage And Synthesis |
| Uses | Tetra-tert-butyldiphenoquinone is an antioxident used in the prevention of aging/rusting in dyes, rubber and textiles. Metabolite of Probucol (P755100) an antilipemic. Probucol USP Related Compound A. |
| | 3,3',5,5'-Tetra-tert-butyldiphenoquinone Preparation Products And Raw materials |
| Raw materials | 3,3',5,5'-TETRA(TERT-BUTYL)[1,1'-BIPHENYL]-4,4'-DIOL-->2,6-Di-tert-butylphenol | | Preparation Products | 4,4'-Ethylenebis(2,6-ditert-butylphenol)-->4-(3,5-Di-tert-butyl-4-hydroxybenzylidene)-2,6-di-tert-butyl-2,5-cyclohexadiene-1-one-->2,6-di-tert-butylhydroquinone-->2,6-Di-tert-butyl-p-benzoquinone |
|