|
|
| | 3-METHYLTHIOPROPIONIC ACID Basic information |
| Product Name: | 3-METHYLTHIOPROPIONIC ACID | | Synonyms: | 3-(Methylsulfanyl)propanoic acid;4-Thiapentanoic acid;Propanoic acid, 3-(methylthio)-;Propionic acid, 3-(methylthio)-;3-METHYTHIOPROPIONIC ACID;3-METHYLTHIO PROPIONATE;3-METHYLTHIOPROPIONIC ACID;3-METHYLMERCAPTOPROPIONIC ACID | | CAS: | 646-01-5 | | MF: | C4H8O2S | | MW: | 120.17 | | EINECS: | 211-460-9 | | Product Categories: | | | Mol File: | 646-01-5.mol |  |
| | 3-METHYLTHIOPROPIONIC ACID Chemical Properties |
| Melting point | 16°C | | Boiling point | 130°C 2mm | | density | 1.160 | | refractive index | 1.4884 | | Fp | 130°C/15mm | | storage temp. | Store at -20°C | | pka | 4.29±0.10(Predicted) | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | Odor | sweet sulfurous | | Water Solubility | Water : 25 mg/mL (208.04 mM) | | BRN | 1743054 | | InChI | InChI=1S/C4H8O2S/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6) | | InChIKey | CAOMCZAIALVUPA-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCSC | | LogP | 0.458 (est) |
| Risk Statements | 34 | | Safety Statements | 26-36/37/39 | | RIDADR | 3265 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29309090 |
| Provider | Language |
|
ALFA
| English |
| | 3-METHYLTHIOPROPIONIC ACID Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Definition | ChEBI: A thia fatty acid acid consisting of propionic acid with a methylthio substituent at the 3-position; an intermediate in mammalian methionine metabolism in vitro. The simplest known phytotoxin, it is a blight-inducing toxin produced by the cass
va pathogen Xanthomonas campestris manihotis. |
| | 3-METHYLTHIOPROPIONIC ACID Preparation Products And Raw materials |
|