|
|
| | 1,1,1,3,3,3-HEXAFLUOROISOPROPYL METHACRYLATE Basic information | | Application |
| Product Name: | 1,1,1,3,3,3-HEXAFLUOROISOPROPYL METHACRYLATE | | Synonyms: | 1,1,1,3,3,3-HexafluoroisopropylE;1,1,1,3,3,3-Hexafluoroisopropyl methacrylate, stabilized, 99%;1,1,1,3,3,3-hexafluoro-2-propyl methacrylate;1,1,1,3,3,3-Hexafluoroisopropyl methacrylate 99%;1,1,1,3,3,3-Hexafluoroisopropylmethacrylate99%;1,1,1,3,3,3-HEXAFLUOROISOPROPYL METHACRYLATE, 99%, STAB.;1,1,1,3,3,3-Hexafluoroisopropyl Methacrylate (stabilized with MEHQ);Methacryl | | CAS: | 3063-94-3 | | MF: | C7H6F6O2 | | MW: | 236.11 | | EINECS: | 221-309-9 | | Product Categories: | Acrylic Monomers;Fluorinated AcrylicsSelf Assembly&Contact Printing;Fluorine-Containing Monomers for 157 nm UV Lithography Resist PolymersPhotonic and Optical Materials;Lithography Monomers;Low Refractive Index Monomers;Monomers;Waveguide Materials;monomer | | Mol File: | 3063-94-3.mol |  |
| | 1,1,1,3,3,3-HEXAFLUOROISOPROPYL METHACRYLATE Chemical Properties |
| Boiling point | 99 °C | | density | 1.302 g/mL at 25 °C(lit.) | | vapor pressure | 0.71 psi ( 20 °C) | | refractive index | n20/D 1.331(lit.) | | Fp | 58 °F | | storage temp. | Flammables area | | form | Liquid | | Specific Gravity | 1.304 | | color | Clear colorless | | InChI | InChI=1S/C7H6F6O2/c1-3(2)4(14)15-5(6(8,9)10)7(11,12)13/h5H,1H2,2H3 | | InChIKey | FMQPBWHSNCRVQJ-UHFFFAOYSA-N | | SMILES | C(OC(C(F)(F)F)C(F)(F)F)(=O)C(C)=C | | EPA Substance Registry System | Hexafluoroisopropyl methacrylate (3063-94-3) |
| Hazard Codes | F,Xn,Xi | | Risk Statements | 11-20/21/22-36/37/38 | | Safety Statements | 16-26-33-36 | | RIDADR | UN 3272 3/PG 2 | | WGK Germany | 3 | | Hazard Note | Flammable/Irritant | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29161900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,1,1,3,3,3-HEXAFLUOROISOPROPYL METHACRYLATE Usage And Synthesis |
| Application | Hexafluoroisopropyl methacrylate (HFA) is a transparent, colorless liquid. It is primarily used in the synthesis of resins and coatings to improve their weather resistance, water resistance, and stain resistance; it is also used as a sheathing material for plastic optical fibers, as well as in contact lenses and computer toners. Furthermore, it can be used as an intermediate in pharmaceuticals and pesticides. | | Chemical Properties | Clear colorless liquid | | Synthesis | To a 1L four-necked flask equipped with mechanical stirring, condenser tube (water-cooled), and thermometer was added 1.5 g of p-methoxyphenol, 30%
fuming sulfuric acid 60 g, stirring, and then add dropwise at room temperature a mixture of methacrylic acid and hexafluoroisopropanol, to which methacrylic acid 103 g (1.5 g) was added.
acid 103 g (1.2 mol), hexafluoroisopropanol 168 g (1 mol); the reaction was exothermic, and the titration time was about 20 min; at the end of the titration, the
After the end of the reaction, the reaction was warmed up to 94C for about 3 h. After the end of the reaction, hexafluoroisopropyl methacrylate 217 g was obtained by simple distillation at atmospheric pressure, the yield was about 92%, no need to further refinement.
The content of hexafluoroisopropyl methacrylate reached 99.2% without further purification. |
| | 1,1,1,3,3,3-HEXAFLUOROISOPROPYL METHACRYLATE Preparation Products And Raw materials |
|